Kadsuralignan A | MedChemExpress (MCE)
Kadsuralignan A (compound 1) is a dibenzocyclooctadiene lignan isolated from the leaves and stems of Schisandra lancifolia. Kadsuralignan A has anti-HIV activity with EC50=2.23 μg/mL[1].
| Trivial name | Kadsuralignan A |
| Catalog Number | HY-N11939 |
| Research Area | Infection |
| CAS# | 913237-64-6 |
| Purity | ≥98.00% |
| SMILES | COC1=C2C(OCO2)=CC3=C1C4=C(OC)C(OC)=C(O)C=C4C[C@@H](C)[C@@H](C)[C@H]3O |
| PubChem Chemical Structure ID | 145709380 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/kadsuralignan-a.html |