DiethylStilbesterol D8
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-11074 |
| Alternative Name(s) | 4-[(3E)-4-[4-hydroxy(3,5-D2)phenyl](2,2,5,5- D4)hex-3-en-3-yl](2,6-D2)phenol |
| Research Area | Labeled Diethylstilbestrol, intended for use as an internal standard for the quantification of Diethylstilbestrol by GC- or LC-mass spectrometry. |
| Molecular Formula | NULL |
| CAS# | 91318-10-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC([2H])([2H])/C(C1=CC([2H])=C(O)C([2H])=C1)=C(C2=CC([2H])=C(O)C([2H])=C2)/C([2H])([2H])C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11074.html |
| Additional Information | NULL |
