Rabusertib (LY2603618)
Rabusertib (LY2603618, IC-83) is a highly selective Chk1 inhibitor with potential anti-tumor activity in a cell-free assay. IC50=7 nM, showing approximately 100-fold more potent against Chk1 than against any of the other protein kinases evaluated. Rabusertib (LY2603618) induces cell cycle arrest, DNA damage response and autophagy in cancer cells. Rabusertib (LY2603618) induces bak-dependent apoptosis in AML cell lines.
| Trivial name | IC-83 |
| Catalog Number | S2626 |
| Molecular Formula | C20H15NO3 |
| CAS# | 911222-45-2 |
| Inchi | InChI=1S/C20H15NO3/c22-19(17-8-4-5-9-18(17)20(23)24)21-16-12-10-15(11-13-16)14-6-2-1-3-7-14/h1-13H,(H,21,22)(H,23,24) |
| Inchi Key | SLUINPGXGFUMLL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)NC(=O)C3=CC=CC=C3C(=O)O |
| Size | 50mg |
| Supplier Page | http://www.selleckchem.com/products/LY2603618-IC-83.html |
| Additional Information | https://file.selleck.cn/downloads/struct/LY2603618-chemical-structure-s2626.gif |
