Setileuton | MedChemExpress (MCE)
Setileuton (MK-0633) is an inhibitor for 5-lipoxygenase, that inhibits the oxidation of arachidonic acid by recombinant human 5-LO, and the production of LTB4 in calcium ionophore-stimulated human whole blood, with IC50 of 3.9 and 52 nM, respectively[1].
| Trivial name | Setileuton |
| Catalog Number | HY-10437 |
| Alternative Name(s) | MK-0633 |
| Research Area | Inflammation/Immunology |
| CAS# | 910656-27-8 |
| Purity | ≥98.0% |
| SMILES | O=C1C=C(C2=CC=C(C=C2)F)C3=CC=C(CNC4=NN=C([C@](CC)(O)C(F)(F)F)O4)C=C3O1 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/setileuton.html |