4SC-202 10mM * 1mL in DMSO
4SC-202 is an orally bioavailable benzamide and inhibitor of human class I histone deacetylases (HDACs) isoenzymes 1, 2 and 3, with potential antineoplastic activity.
Trivial name | 4SC-202 10mM * 1mL in DMSO |
Catalog Number | A14354-10mM-D |
Alternative Name(s) | (E)-N-(2-aminophenyl)-3-(1-((4-(1-methyl-1H-pyrazol-4-yl)phenyl)sulfonyl)-1H-pyrrol-3-yl)acrylamide 4-methylbenzenesulfonate |
Molecular Formula | C23H21N5O3S |
CAS# | 910462-43-0 |
SMILES | CN1C=C(C=N1)C2=CC=C(C=C2)S(=O)(=O)N3C=CC(=C3)/C=C/C(=O)NC4=CC=CC=C4N |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/4sc-202.html |