Benzhydrol
Diphenylmethanol is a secondary alcohol that is diphenylmethane which carries a hydroxy group at position 1. It has a role as a rat metabolite, a bacterial xenobiotic metabolite, a human xenobiotic metabolite and a human urinary metabolite. It is a secondary alcohol and a member of benzyl alcohols. It derives from a hydride of a diphenylmethane.
| Catalog Number | INT91010 |
| Alternative Name(s) | Diphenylmethanol Diphenylcarbinol Benzohydrol |
| Research Area | Intermediates |
| Molecular Formula | C13H12O |
| CAS# | 91-01-0 |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)O |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/benzhydrol-item-9232.html |