Miconazole EP impurity G
it is an isomer of Miconazole ; a 2,5-dichloro-substitution at the benzyl ring. 2,5-Dichlorobenzyl Miconazole is a potent antifungal agent.;Impurity in commercial preparations of Miconazole
| Catalog Number | CS-O-07925 |
| Alternative Name(s) | Miconazole EP impurity G;2,5(2,4[(2,5-dichlorophenyl)methoxy]ethyl]-1H-imidazole Nitrate; 1-[2-(2,4-Dichlorophenyl)-2-[(2,5-dichlorophenyl)methoxy]ethyl]-1H-imidazole Mononitrate |
| CAS# | 909277-72-1 |
| Purity | >98% |
| SMILES | O=[N](O)=O.ClC1=C(C=CC(Cl)=C1)C(OCC(C=C(Cl)C=C2)=C2Cl)CN3C=CN=C3 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO07925.html |