Neochlorogenic acid 50mg
Neochlorogenic acid is a natural polyphenolic compound found in some types dried fruits and a variety of other plant sources such as peach
| Trivial name | Neochlorogenic acid 50mg |
| Catalog Number | A12093-50 |
| Alternative Name(s) | 5-Caffeoylquinic acid; trans-5-O-Caffeoyl-D-quinate; (1R,3R,4S,5R)-5-[(E)-3-(3,4-Dihydroxyphenyl)prop-2-enoyl]oxy-1,3,4-trihydroxycyclohexane-1-carboxylic acid |
| Molecular Formula | C16H18O9 |
| CAS# | 906-33-2 |
| SMILES | C1[C@H]([C@@H]([C@@H](C[C@]1(C(=O)O)O)OC(=O)/C=C/C2=CC(=C(C=C2)O)O)O)O |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/neochlorogenic-acid.html |