AZ-960 5mg
AZ-960 is a potent, selective and ATP competitive JAK2 inhibitor that inhibits JAK2 kinase with a Ki of 0.45 nM in vitro and induces growth arrest and apoptosis in adult T-cell leukemia (ATL) cell.
| Trivial name | AZ-960 5mg |
| Catalog Number | A10104-5 |
| Alternative Name(s) | 5-Fluoro-2-[[(1S)-1-(4-fluorophenyl)ethyl]amino]-6-[(5-methyl-1H-pyrazol-3-yl)amino]-3-pyridinecarbonitrile |
| Molecular Formula | C18H16F2N6 |
| CAS# | 905586-69-8 |
| SMILES | CC1=CC(=NN1)NC2=C(C=C(C(=N2)N[C@@H](C)C3=CC=C(C=C3)F)C#N)F |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/az-960.html |
