URB694 | MedChemExpress (MCE)
URB694 is a carbamate FAAH inhibitor that irreversibly carbamoylate the nucleophile catalytic serine in FAAH active site. URB694 exhibits antidepressant-like activity and cardioprotective effects. URB694 can be used to prepare 11C-Carbonyl-URB694 for in vivo positron emission tomography (PET) imaging studies of the brain FAAH[1][2].
| Trivial name | URB694 |
| Catalog Number | HY-W728451 |
| Research Area | Neurological Disease; Cardiovascular Disease |
| CAS# | 904672-77-1 |
| Purity | ≥98.0% |
| SMILES | O=C(OC=1C=CC(O)=C(C1)C=2C=CC=CC2)NC3CCCCC3 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/urb694.html |