Heparin Lithium
Heparin Lithium is a mucopolysaccharide that is used primarily as an anticoagulant. Heparin binds to antithrombin III and accelerates the rate of inhibition of coagulation proteases.
| Catalog Number | API9045221 |
| Alternative Name(s) | 4-hydroxy-6-[4-hydroxy-6-methoxy-5-(sulfoamino)-2-(sulfooxymethyl)oxan-3-yl]oxy-3-methoxy-5-sulfooxyoxane-2-carboxylic acid |
| Research Area | AnticoagulantAntiplatelet APIs |
| Molecular Formula | C14H25NO20S3 |
| CAS# | 9045-22-1 |
| SMILES | COC1C(C(C(OC1C(=O)O)OC2C(OC(C(C2O)NS(=O)(=O)O)OC)COS(=O)(=O)O)OS(=O)(=O)O)O |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/heparin-lithium-item-11616.html |