Heparin sodium 5000mg
Heparin, also known as unfractionated heparin, a highly sulfated glycosaminoglycan, is widely used as an injectable anticoagulant, and has the highest negative charge density of any known biological molecule.
Trivial name | Heparin sodium 5000mg |
Catalog Number | A11726-5000 |
Alternative Name(s) | N/A |
Molecular Formula | (C12H16NS2Na3)20 |
CAS# | 9041-08-1 |
SMILES | C([C@@H]1C([C@@H](C(C(O1)O)NS(=O)(=O)[O-])O)O[C@H]2C([C@H](C(C(O2)C(=O)[O-])O)O)OS(=O)(=O)[O-])OS(=O)(=O)[O-] |
Size | 5000mg |
Supplier Page | http://www.adooq.com/heparin-sodium.html |