Bicalutamide Intermediate (epoxy)
Bicalutamide Epoxide Impurity is an intermediate in synthesis of more complex pharmaceutical compounds. It is used in the synthesis of potential impurities of Bicalutamide.
Catalog Number | INT90357510 |
Alternative Name(s) | N-(4-cyano-3-(trifluoromethyl)phenyl)-2-methyloxirane-2-carboxamide N-[4-Cyano-3-(trifluoromethyl)phenyl]methacrylamide epoxide N-[4-cyano-3-(trifluoromethyl)phenyl]-2-methyloxirane-2-carboxamide N-[4-cyano-3-(trifluoromethyl)phenyl]-2-methyl-2-oxiranecarboxamide |
Research Area | Intermediates |
Molecular Formula | C12H9F3N2O2 |
CAS# | 90357-51-0 |
SMILES | CC1(CO1)C(=O)NC2=CC(=C(C=C2)C#N)C(F)(F)F |
Size | inquiry |
Supplier Page | https://www.protheragen-ing.com/bicalutamide-intermediate-epoxy-item-12048.html |