trans-Latanoprost acid | MedChemExpress (MCE)
trans-Latanoprost acid is an isomer of Latanoprost acid. trans-Latanoprost acid may have the activity of reducing intraocular pressure. trans-Latanoprost acid is mainly prepared as an analytical standard for impurity detection and quantification[1].
| Trivial name | trans-Latanoprost acid |
| Catalog Number | HY-113756 |
| Research Area | Others |
| CAS# | 903549-49-5 |
| Purity | ≥98.0% |
| SMILES | OC(CCC/C=C/C[C@@H]1[C@H]([C@@H](C[C@@H]1O)O)CC[C@@H](O)CCC2=CC=CC=C2)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/trans-latanoprost-acid.html |