AT7519 HCl 10mM * 1mL in DMSO
AT7519 is an inhibitor of multiple cyclin-dependent kinases (CDKs), which may result in cell cycle arrest, induction of apoptosis, and inhibition of tumor cell proliferation.
Trivial name | AT7519 HCl 10mM * 1mL in DMSO |
Catalog Number | A11313-10mM-D |
Alternative Name(s) | N-(4-Piperidinyl)-4-(2,6-dichlorobenzoylamino)-1H-pyrazole-3-carboxamide hydrochloride |
Molecular Formula | C16H17Cl2N5O2.HCl |
CAS# | 902135-91-5 |
SMILES | C1CNCCC1NC(=O)C2=C(C=NN2)NC(=O)C3=C(C=CC=C3Cl)Cl.Cl |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/at7519-hcl.html |