dGMP.H2
2′-Deoxyguanosine-5′-monophosphate, a nucleotide molecule and a key player in DNA synthesis, holds immense potential in the development of antiviral drugs as well as in treating various cancers. This biochemical marker is additionally crucial in detecting and measuring DNA damage, a necessary step in studying the complex mechanisms of DNA replication and repair.
Catalog Number | PIPB-0472 |
Alternative Name(s) | 2'-deoxyguanosine 5'-monophosphate Deoxyguanylic acid Deoxy-GMP dGMP Deoxyguanosine 5'-monophosphate |
Research Area | dNMP&NMP |
Molecular Formula | C10H14N5O7P |
CAS# | 902-04-5 |
SMILES | C1C(C(OC1N2C=NC3=C2N=C(NC3=O)N)COP(=O)(O)O)O |
Size | inquiry |
Supplier Page | https://www.protheragen-ing.com/dgmph2-item-10590.html |