Fetuin, Fetal Bovine Serum
Fetuin, Fetal Bovine Serum, a prevalent protein found in fetal bovine plasma, is the bovine equivalent of human α2HS glycoprotein (α2HS), commonly used as a supplement in various serum-free media. It inhibits trypsin activity and enhances cellular attachment, growth, and differentiation in culture systems.
| Trivial name | Fetal Bovine Serum |
| Catalog Number | P1243 |
| Molecular Formula | C17H15FN6O3 |
| CAS# | 9014-81-7 |
| Inchi | InChI=1S/C17H15FN6O3/c1-23-21-16(20-22-23)15-5-2-10(7-19-15)13-4-3-11(6-14(13)18)24-8-12(9-25)27-17(24)26/h2-7,12,25H,8-9H2,1H3/t12-/m1/s1 |
| Inchi Key | XFALPSLJIHVRKE-GFCCVEGCSA-N |
| SMILES | CN1N=C(N=N1)C2=NC=C(C=C2)C3=C(C=C(C=C3)N4CC(OC4=O)CO)F |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/fetuin-fetal-bovine-serum.html |
| Additional Information | https://file.selleck.cn/downloads/struct/P1243-Fetuin-Fetal-Bovine-Serum-chemical-structure-tube.png |
