Droxicam
Droxicam is a non-steroidal anti-inflammatory drug of the oxicam class. As a prodrug of piroxicam, it is used for the relief of pain and inflammation in musculoskeletal disorders such as rheumatoid arthritis and osteoarthritis.
| Trivial name | Ombolan |
| Catalog Number | CSN10874 |
| Alternative Name(s) | Ombolan |
| Research Area | Infection |
| Molecular Formula | C16H11N3O5S |
| CAS# | 90101-16-9 |
| Purity | ≥98% |
| SMILES | O=C(N1C2=NC=CC=C2)OC(C3=CC=CC=C34)=C(N(C)S4(=O)=O)C1=O |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/droxicam.html |