Ovalbumins
Ovalbumin is a major glycoprotein found in egg whites, serving as a nutrient reserve for developing embryos and used in the food industry. It also induces a Th2 immune response in sensitized individuals, characterized by the production of cytokines like IL-4, IL-5, and IL-13, leading to airway inflammation, hyper-responsiveness (AHR), and immune cell infiltration, key features in asthma models.
| Catalog Number | E5767 |
| Molecular Formula | C12H9F3N2O2 |
| CAS# | 9006-59-1 |
| Inchi | InChI=1S/C12H9F3N2O2/c1-7-10(6-16-19-7)11(18)17-9-4-2-8(3-5-9)12(13,14)15/h2-6H,1H3,(H,17,18) |
| Inchi Key | VHOGYURTWQBHIL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NO1)C(=O)NC2=CC=C(C=C2)C(F)(F)F |
| Size | 1g |
| Supplier Page | http://www.selleckchem.com/products/ovalbumins.html |
| Additional Information | https://file.selleck.cn/downloads/struct/E5767-Ovalbumins-chemical-structure-tube.png |
