AS-252424 10mM * 1mL in DMSO
AS-252424 is a potent inhibitor of PI3K with selectivity for the ?? isoform. It inhibits human recombinant PI3K??, ??, ??, and ?? with IC50 values of 30, 940, 20,000, and 20,000 nM respectively.
Trivial name | AS-252424 10mM * 1mL in DMSO |
Catalog Number | A11099-10mM-D |
Alternative Name(s) | 5-[5-(4-fluoro-2-hydroxy-phenyl)-furan-2-ylmethylene]-thiazolidine-2,4-dione |
Molecular Formula | C14H8FNO4S |
CAS# | 900515-16-4 |
SMILES | C1=CC(=C(C=C1F)O)C2=CC=C(O2)/C=C3/C(=O)NC(=O)S3 |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/as-252424.html |