AS-252424 10mg
AS-252424 is a potent inhibitor of PI3K with selectivity for the ?? isoform. It inhibits human recombinant PI3K??, ??, ??, and ?? with IC50 values of 30, 940, 20,000, and 20,000 nM respectively.
| Trivial name | AS-252424 10mg |
| Catalog Number | A11099-10 |
| Alternative Name(s) | 5-[5-(4-fluoro-2-hydroxy-phenyl)-furan-2-ylmethylene]-thiazolidine-2,4-dione |
| Molecular Formula | C14H8FNO4S |
| CAS# | 900515-16-4 |
| SMILES | C1=CC(=C(C=C1F)O)C2=CC=C(O2)/C=C3/C(=O)NC(=O)S3 |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/as-252424.html |
