PF-3274167
Oral oxytocin antagonist Others|Others
| Catalog Number | B5924-100 |
| Research Area | Others|Others |
| Molecular Formula | C19H19ClFN5O3 |
| CAS# | 900510-03-4 |
| Purity | 99.42% |
| SMILES | COCC(N1C2=CN=C(OC)C=C2)=NN=C1N3CC(OC4=C(Cl)C=C(F)C=C4)C3 |
| Size | 100mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B5924 |
