Detomidine hydrochloride 10mM * 1mL in DMSO
Detomidine is a sedative with analgesic properties. ??2-adrenergic agonists produce dose-dependent sedative and analgesic effects, mediatated by activation of ??2 catecholamine receptors, thus inducing a negative feedback response, reducing production of excitatory neurotransmitters.
Trivial name | Detomidine hydrochloride 10mM * 1mL in DMSO |
Catalog Number | A10298-10mM-D |
Alternative Name(s) | 4-[(2,3-Dimethylphenyl)methyl]-1H-imidazole monohydrochloride |
Molecular Formula | C12H14N2.HCl |
CAS# | 90038-01-0 |
SMILES | CC1=C(C(=CC=C1)CC2=CN=CN2)C.Cl |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/detomidine-hydrochloride.html |