Detomidine hydrochloride 10mg
Detomidine is a sedative with analgesic properties. ??2-adrenergic agonists produce dose-dependent sedative and analgesic effects, mediatated by activation of ??2 catecholamine receptors, thus inducing a negative feedback response, reducing production of excitatory neurotransmitters.
| Trivial name | Detomidine hydrochloride 10mg |
| Catalog Number | A10298-10 |
| Alternative Name(s) | 4-[(2,3-Dimethylphenyl)methyl]-1H-imidazole monohydrochloride |
| Molecular Formula | C12H14N2.HCl |
| CAS# | 90038-01-0 |
| SMILES | CC1=C(C(=CC=C1)CC2=CN=CN2)C.Cl |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/detomidine-hydrochloride.html |
