DNase I, Bovine pancreas
DNase I, Bovine pancreas is a Ca²⁺/Mg²⁺-dependent endonuclease that cleaves phosphodiester bonds double-stranded DNA, classified under EC 3.1.21.1 as a hydrolase. It binds to the minor groove of DNA, with key amino acids like R111, Y211, and N170 interacting with the DNA backbone to facilitate catalysis, while residues N74 and S206 in the active site are crucial for substrate binding and DNA recognition. DNase I is essential for DNA degradation, chromatin research, and is widely used to generate smaller DNA fragments for genomic studies and to examine DNA-protein interactions in chromatin remodeling research.
| Catalog Number | E7018 |
| Molecular Formula | C27H37N3O7S.C2H5OH |
| CAS# | 9003-98-9 |
| Inchi | InChI=1S/C27H37N3O7S.C2H6O/c1-18(2)15-30(38(33,34)21-10-8-20(28)9-11-21)16-24(31)23(14-19-6-4-3-5-7-19)29-27(32)37-25-17-36-26-22(25)12-13-35-26;1-2-3/h3-11,18,22-26,31H,12-17,28H2,1-2H3,(H,29,32);3H, 2H2,1H3/t22-,23-,24+,25-,26+;/m0./s1 |
| Inchi Key | QWSHKNICRJHQCY-VBTXLZOXSA-N |
| SMILES | CCO.CC(C)CN(CC(C(CC1=CC=CC=C1)NC(=O)OC2COC3C2CCO3)O)S(=O)(=O)C4=CC=C(C=C4)N |
| Size | 50mg |
| Supplier Page | http://www.selleckchem.com/products/dnase-i-bovine-pancreas.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e7018-dnase-i-bovine-pancreas-chemical-structure-tube.png |
