Triton X-100
Fine Chemical
| Trivial name | NULL |
| Catalog Number | CS-T-62564 |
| Alternative Name(s) | Triton X-100;Octoxynol 9;Polyethylene Glycol Mono-4- octylphenyl Ether n;Polyethylene Gllycol Mono(4-octylphenyl) Ether; Polyethylene Glycol Mono(4-tert-octylphenyl) Ether; Polyoxyethylene Glycol-p-tert-octylphenyl Ether. |
| Research Area | Triton-X 100 is a non-ionic surfactant. Used in the enhancement of film porosity in conducting polymers. |
| Molecular Formula | NULL |
| CAS# | 9002-93-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC(C)(C1=CC=C(OCCO)C=C1)CC(C)(C)C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST62564.html |
| Additional Information | NULL |