PIK-294
highly selective p110δ inhibitor PI3K/Akt/mTOR Signaling|PI3K
| Catalog Number | B2188-S |
| Research Area | PI3K/Akt/mTOR Signaling|PI3K |
| Molecular Formula | C28H23N7O2 |
| CAS# | 900185-02-6 |
| Purity | 98% |
| SMILES | CC1=C2C(=CC=C1)N=C(N(C2=O)C3=CC=CC=C3C)CN4C5=C(C(=N4)C6=CC(=CC=C6)O)C(=NC=N5)N |
| Size | Evaluation Sample |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B2188 |
