PIK-293
PI3K inhibitor PI3K/Akt/mTOR Signaling|PI3K
| Catalog Number | B2187-10 |
| Research Area | PI3K/Akt/mTOR Signaling|PI3K |
| Molecular Formula | C22H19N7O |
| CAS# | 900185-01-5 |
| Purity | 98% |
| SMILES | CC1=C2C(=CC=C1)N=C(N(C2=O)C3=CC=CC=C3C)CN4C5=C(C=N4)C(=NC=N5)N |
| Size | 10mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B2187 |
