4-Methylumbelliferone 100mg
4-Methylumbelliferone is a selective inhibitor of Hyaluronan (HA) synthesis which is thought to function as an inhibitor via the depletion of UDP-glucuronic acid, the common substrate for HA synthesis.
| Trivial name | 4-Methylumbelliferone 100mg |
| Catalog Number | A10015-100 |
| Alternative Name(s) | ??-Methylumbelliferone 4-MU 7-Hydroxy-4-methylcoumarin |
| Molecular Formula | C10H8O3 |
| CAS# | 90-33-5 |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)O |
| Size | 100mg |
| Supplier Page | http://www.adooq.com/4-methylumbelliferone-4-mu.html |
