2-Hydroxybenzyl alcohol
2-Hydroxybenzyl alcohol (Salicyl alcohol, Salicain, Diathesin, Saligenin, Saligenol, o-Methylolphenol, α,2-Toluenediol), which can be found in a number of food items such as red huckleberry, rye, jerusalem artichoke, and ceylon cinnamon, is precursor of salicylic acid and is formed from salicin by enzymatic hydrolysis by Salicyl-alcohol beta-D-glucosyltransferase or by acid hydrolysis.
| Trivial name | Salicain, Diathesin, Saligenin, Saligenol, o-Methylolphenol, α,2-Toluenediol |
| Catalog Number | S5562 |
| Molecular Formula | C23H22N8O |
| CAS# | 90-01-7 |
| SMILES | CC1=C(C=CC=C1C2=CC(=NC(=N2)N)C3=CN(N=N3)CC4=NC(=CC=C4)C(C)(C)O)C#N |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/2-hydroxybenzyl-alcohol.html |
| Additional Information | https://file.selleck.cn/downloads/struct/2-hydroxybenzyl-alcohol-chemical-structure-s5562.gif |
