Aceclofenac
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-07106 |
| Alternative Name(s) | NULL |
| Research Area | Aceclofenac is a non-steroidal anti-inflammatory drug (NSAID) analog of Diclofenac. It is used for the relief of pain and inflammation in rheumatoid arthritis, osteoarthritis and ankylosing spondylitis. It is a cytokine inhibitor. Aceclofenac works. |
| Molecular Formula | C16H1Cl2NO4 |
| CAS# | 89796-99-6 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | ClC1=C(C(Cl)=CC=C1)NC(C=CC=C2)=C2CC(OCC(O)=O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO07106.html |
| Additional Information | NULL |