Tazobactam acid
API Standard
| Catalog Number | CS-O-02523 |
| Alternative Name(s) | (2S,3S,5R)-3-((1H-1,2,3-triazol-1-yl)methyl)-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid 4,4-dioxide |
| Research Area | Tazobactam Base is a penicillanic acid sulfone derivative and beta-lactamase inhibitor with antibacterial activity. Tazobactam contains a beta-lactam ring and irreversibly binds to beta-lactamase at or near its active site. This protects other beta-lactam |
| Molecular Formula | C10H12N4O5S |
| CAS# | 89786-04-09 |
| Purity | >98% |
| SMILES | C[C@]([C@@H](N1[C@@]2([H])CC1=O)C(O)=O)([S]2(=O)=O)CN3C=CN=N3 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02523.html |
