AST-1306 100mg
AST-1306, a novel anilino-quinazoline compound, inhibits the enzymatic activities of wild-type epidermal growth factor receptor (EGFR) and ErbB2 as well as EGFR resistant mutant in both cell-free and cell-based systems.
| Trivial name | AST-1306 100mg |
| Catalog Number | A11155-100 |
| Alternative Name(s) | N-[4-[[3-Chloro-4-[(3-fluorobenzyl)oxy]phenyl]amino]quinazolin-6-yl]acrylamide |
| Molecular Formula | C24H18ClFN4O2 |
| CAS# | 897383-62-9 |
| SMILES | C=CC(=O)NC1=CC2=C(C=C1)N=CN=C2NC3=CC(=C(C=C3)OCC4=CC(=CC=C4)F)Cl |
| Size | 100mg |
| Supplier Page | http://www.adooq.com/ast-1306.html |
