AT9283
AT9283 is a potent JAK2/3 inhibitor with IC50 of 1.2 nM/1.1 nM in cell-free assays; also potent to Aurora A/B, Abl1(T315I).
| Trivial name | N/A |
| Catalog Number | S1134 |
| Molecular Formula | C17H13NaO4 |
| CAS# | 896466-04-9 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | [Na+].COC1=CC=CC=C1C(=O)/C=C/C2=CC=CC=C2C([O-])=O |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/AT9283.html |
| Additional Information | https://file.selleck.cn/downloads/struct/AT9283-chemical-structure-S1134.gif |
