Tropisetron (ICS 205930) 10mM * 1mL in DMSO
Tropisetron is a serotonin 5-HT3 receptor antagonist used mainly as an antiemetic to treat nausea and vomiting following chemotherapy.
| Trivial name | Tropisetron (ICS 205930) 10mM * 1mL in DMSO |
| Catalog Number | A11226-10mM-D |
| Alternative Name(s) | (3-endo)-8-Methyl-8-azabicyclo[3.2. 1]oct-3-yl 1H-indole-3-carboxylic acid ester monohydrochloride |
| Molecular Formula | C17H20N2O2.HCl |
| CAS# | 89565-68-4 |
| SMILES | CN1[C@@H]2CC[C@H]1CC(C2)OC(=O)C3=CNC4=CC=CC=C43 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/tropisetron.html |