Flumatinib mesylate 500mg
Flumatinib mesylate can reduce the expression of C-MYC, HIF-1 a and VEGF in U266 cell line in a time- and dose-dependent manners, so flumatinib mesylate may become a new drug for MM therapy.
| Trivial name | Flumatinib mesylate 500mg |
| Catalog Number | A13530-500 |
| Alternative Name(s) | BenzaMide, 4-[(4-Methyl-1-piperazinyl)Methyl]-N-[6-Methyl-5-[[4-(3-pyridinyl)-2-pyriMidinyl]aMino]-3-pyridinyl]-3-(trifluoroMethyl)- |
| Molecular Formula | C30H33F3N8O4S |
| CAS# | 895519-91-2 |
| SMILES | CC1=C(C=C(C=N1)NC(=O)C2=CC(=C(C=C2)CN3CCN(CC3)C)C(F)(F)F)NC4=NC=CC(=N4)C5=CN=CC=C5.CS(=O)(=O)O |
| Size | 500mg |
| Supplier Page | http://www.adooq.com/flumatinib-mesylate.html |