LDH-IN-2 | MedChemExpress (MCE)
LDH-IN-2, a salicylic acid derivative, is an inhibitor of glycolate oxidase (GO). LDH-IN-2 decreases oxalate output in hyperoxaluric hepatocytes. LDH-IN-2 can be used for research of primary hyperoxaluria type 1 (PH1)[1].
| Trivial name | LDH-IN-2 |
| Catalog Number | HY-148610 |
| Research Area | Metabolic Disease |
| CAS# | 893739-96-3 |
| Purity | ≥98.00% |
| SMILES | O=C(C1=C(O)C=CC(C2=CC=CO2)=C1)O |
| PubChem Chemical Structure ID | 20100073 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/ldh-in-2.html |