Mca-Pro-Leu-Gly-Leu-Glu-Glu-Ala-Dap(Dnp)-NH2 | MedChemExpress (MCE)
Mca-Pro-Leu-Gly-Leu-Glu-Glu-Ala-Dap(Dnp)-NH2 is highly selective substrate for matrix metalloproteases 12 (MMP12) substrate with a kcat/Km value of 1.85*105 M-1s-1, and poor substrate of other MMPs with the exception of MMP13 (kcat/Km = 0.53*105 M-1s-1) and MMP9 (0.33*105 M-1s-1)[1].
| Trivial name | Mca-Pro-Leu-Gly-Leu-Glu-Glu-Ala-Dap(Dnp)-NH2 |
| Catalog Number | HY-P4905 |
| Research Area | Cancer |
| CAS# | 891198-38-2 |
| Purity | ≥98.00% |
| SMILES | O=C(N1[C@@H](CCC1)C(N[C@@H](CC(C)C)C(NCC(N[C@@H](CC(C)C)C(N[C@@H](CCC(O)=O)C(N[C@@H](CCC(O)=O)C(N[C@@H](C)C(N[C@H](C(N)=O)CNC2=C(C=C(C=C2)[N+]([O-])=O)[N+]([O-])=O)=O)=O)=O)=O)=O)=O)=O)CC(C3=CC=C(OC)C=C3O4)=CC4=O |
| PubChem Chemical Structure ID | 131863087 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/mca-pro-leu-gly-leu-glu-glu-ala-dap-dnp-nh2.html |