2′-Deoxyinosine
2′-Deoxyinosine can be used as a model compound to study the chemistry of adduct formation and radical chemistry that may affect DNA structures. It is a nucleoside composed of hypoxanthine attached to 2′-deoxyribose via a β-N9-glycosidic bond.
| Trivial name | / |
| Catalog Number | CSN23283 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C10H12N4O4 |
| CAS# | 890-38-0 |
| Purity | ≥99% |
| SMILES | OC1=C2N=CN([C@@H]3O[C@H](CO)[C@@H](O)C3)C2=NC=N1 |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/2'-deoxyinosine.html |