INCB 3284 dimesylate 100mg
INCB 3284 dimesylate is a potent, selective hCCR2 antagonist that exhibits potenct antagonism against monocyte chemoattractant molecule binding to hCCR2 and chemotaxis activity.
| Trivial name | INCB 3284 dimesylate 100mg |
| Catalog Number | A11104-100 |
| Alternative Name(s) | N-[2-[[(3R)-1-[trans-4-Hydroxy-4-(6-methoxy-3-pyridinyl)cyclohexyl]-3-pyrrolidinyl]amino]-2-oxoethyl]-3-(trifluoromethyl)-benzamide dimethanesulfonate |
| Molecular Formula | C26H31F3N4O4.2CH4O3S |
| CAS# | 887401-93-6 |
| SMILES | COC1=NC=C(C=C1)C2(CCC(CC2)N3CC[C@H](C3)NC(=O)CNC(=O)C4=CC(=CC=C4)C(F)(F)F)O.CS(=O)(=O)O.CS(=O)(=O)O |
| Size | 100mg |
| Supplier Page | http://www.adooq.com/incb-3284-dimesylate.html |