GW814408X | MedChemExpress (MCE)
GW814408X is a kinase chemical genome group (KCGS) compound that inhibits the AURKC kinase involved in cell cycle progression, checkpoint regulation, and cell division. GW814408X exhibits cell line-dependent toxicity, e.g., cytotoxic effects on HeLa cells. GW814408X acts as a protein kinase inhibitor across ATP-dependent and -independent luciferases with potential implications for Fluc reporter assays[1].
Trivial name | GW814408X |
Catalog Number | HY-160691 |
Research Area | Others |
CAS# | 886599-05-9 |
Purity | ≥98.0% |
SMILES | COC1=CC(C2=CNC3=C2N=CN=C3N/N=C/C4=CC=NC=C4)=CC=C1 |
Size | 1 mg |
Supplier Page | https://www.medchemexpress.com/gw814408x.html |