3-Piperidinopropiophenone Hydrochloride
Fine Chemicals
| Trivial name | NULL |
| Catalog Number | CS-T-40121 |
| Alternative Name(s) | 3-Piperidinopropiophenone Hydrochloride;3-(1-Piperidinyl)propiophenone Hydrochloride;1-phenyl-3-(piperidin-1-yl)propan-1-one hydrochloride |
| Research Area | 3-Piperidinopropiophenone is a mono Mannich base derived from acetophenone with antibacterial, antifungal and antitumor activity. 3-Piperidinopropiophenone shows cytotoxicity againts Jurkat cells. |
| Molecular Formula | C14H20ClNO |
| CAS# | 886-06-06 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(C1=CC=CC=C1)CCN2CCCCC2.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST40121.html |
| Additional Information | NULL |