Artesunate
Artesunate is a part of the artemisinin group of agents with an IC50 of < 5 μM for small cell lung carcinoma cell line H69. It is a potential inhibitor of STAT-3 and EXP1 and exhibits selective cytotoxicity of cancer cells over normal cells in vitro.
| Trivial name | WR 256283 |
| Catalog Number | CSN13071 |
| Alternative Name(s) | WR 256283 |
| Research Area | Cancer|Infection |
| Molecular Formula | C19H28O8 |
| CAS# | 88495-63-0 |
| Purity | ≥98% |
| SMILES | O=C(O)CCC(O[C@H]1O[C@@]2([H])[C@@]3(OO[C@](O2)(C)CC4)[C@]4([H])[C@H](C)CC[C@@]3([H])[C@H]1C)=O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/artesunate.html |