E 64d 10mM * 1mL in DMSO
E-64d is an inhibitor of cathepsins B and L and it is lysosome and cell permeable.
| Trivial name | E 64d 10mM * 1mL in DMSO |
| Catalog Number | A13259-10mM-D |
| Alternative Name(s) | ethyl (2S,3S)-3-[[(2S)-4-methyl-1-(3-methylbutylamino)-1-oxopentan-2-yl]carbamoyl]oxirane-2-carboxylate |
| Molecular Formula | C17H30N2O5 |
| CAS# | 88321-09-9 |
| SMILES | CCOC(=O)[C@@H]1[C@H](O1)C(=O)N[C@@H](CC(C)C)C(=O)NCCC(C)C |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/e-64d.html |
