Amlodipine D4 Maleate
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02810 |
| Alternative Name(s) | Amlodipine D4 Maleic Acid;2-[(2-Aminoethoxy)methyl]-4-methyl-1,4-dihydropyridine-d4 Malec cid Salt; |
| Research Area | A deuterated dihydropyridine calcium channel blocker.;Application of Labeled APIs: Labeled Amlodipine, intended for use as an internal standard for the quantification of Amlodipine by GC- or LC-mass spectrometry. |
| Molecular Formula | NULL |
| CAS# | 88150-47-4 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(/C=CC(O)=O)=O.O=C(C(C(C(C([2H])=C([2H])C([2H])=C1[2H])=C1Cl)C(C(OC)=O)=C(C)N2)=C2COCCN)OCC |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02810.html |
| Additional Information | NULL |