AMD-070 hydrochloride 10mg
AMD-070 hydrochloride is a potent and selective antagonist of CXCR4 with an IC50 value of 13 nM in a CXCR4 125I-SDF inhibition binding assay, inhibit the replication of T-tropic HIV-1 (NL4.3 strain) in MT-4 cells and PBMCs.
| Trivial name | AMD-070 hydrochloride 10mg |
| Catalog Number | A14997-10 |
| Alternative Name(s) | N'-(1H-benzimidazol-2-ylmethyl)-N'-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]butane-1,4-diamine,hydrochloride |
| Molecular Formula | C21H30Cl3N5 |
| CAS# | 880549-30-4 |
| SMILES | C1CC(C2=C(C1)C=CC=N2)N(CCCCN)CC3=NC4=CC=CC=C4N3.Cl |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/amd-070-hydrochloride.html |
