Cefepime
Cefepime (BMY-28142) is a fourth-generation cephalosporin used to treat a wide range of Gram-positive and Gram-negative bacterial infections. It is approved for the management of pneumonia, urinary tract infections, skin and soft-tissue infections, intra-abdominal infections, and febrile neutropenia. Cefepime exerts its bactericidal effect by covalently binding and inhibiting penicillin-binding proteins (PBPs), thereby disrupting the final step of bacterial cell wall synthesis and leading to cell death.
| Trivial name | BMY-28142 |
| Catalog Number | E7089 |
| Molecular Formula | C24H21F2NO3 |
| CAS# | 88040-23-7 |
| Inchi | InChI=1S/C24H21F2NO3/c25-17-5-1-15(2-6-17)22(29)14-13-21-23(16-3-11-20(28)12-4-16)27(24(21)30)19-9-7-18(26)8-10-19/h1-12,21-23,28-29H,13-14H2/t21-,22+,23-/m1/s1 |
| Inchi Key | OLNTVTPDXPETLC-XPWALMASSA-N |
| SMILES | C1=CC(=CC=C1C2C(C(=O)N2C3=CC=C(C=C3)F)CCC(C4=CC=C(C=C4)F)O)O |
| Size | 50mg |
| Supplier Page | http://www.selleckchem.com/products/cefepime.html |
| Additional Information | https://file.selleck.cn/downloads/struct/E7089-Cefepime-chemical-structure.png |
