GDC-0449 (Vismodegib) 10mM * 1mL in DMSO
GDC-0449 (Vismodegib) is a more potent novel and specific synthetic oral hedgehog pathway inhibitor with an IC50 of 3 nM.
| Trivial name | GDC-0449 (Vismodegib) 10mM * 1mL in DMSO |
| Catalog Number | A10258-10mM-D |
| Alternative Name(s) | 2-chloro-N-[4-chloro-3-(pyridin-2-yl)phenyl]-4-(methylsulfonyl)benzamide |
| Molecular Formula | C19H14Cl2N2O3S |
| CAS# | 879085-55-9 |
| SMILES | CN1C=NC2=C1C=C(C(=C2F)NC3=C(C=C(C=C3)Br)Cl)C(=O)NOCCO |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/gdc-0449-vismodegib.html |
