Lesinurad 5mg
Lesinurad is a selective uric acid re-absorption inhibitor (SURI) and is also a selective inhibitor of URAT1, a transporter in the kidney that regulates uric acid excretion from the body.
| Trivial name | Lesinurad 5mg |
| Catalog Number | A12981-5 |
| Alternative Name(s) | 2-((5-bromo-4-(4-cyclopropylnaphthalen-1-yl)-4H-1,2,4-triazol-3-yl)thio)acetic acid |
| Molecular Formula | C17H14BrN3O2S |
| CAS# | 878672-00-5 |
| SMILES | C1CC1C2=CC=C(C3=CC=CC=C23)N4C(=NN=C4Br)SCC(=O)O |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/lesinurad.html |
