Fostriecin sodium | MedChemExpress (MCE)
Fostriecin (sodium) (compound 1, CI-920) is an antibiotic with a cytotoxic activity. Fostriecin (sodium) is also an inhibitor of protein phosphatase including PP4 (IC50= 3 nM)and PP2 (IC50=1.5 nM)[1].
| Trivial name | Fostriecin sodium |
| Catalog Number | HY-106702 |
| Alternative Name(s) | CI-920 |
| Research Area | Cancer |
| CAS# | 87860-39-7 |
| Purity | ≥98.0% |
| SMILES | O=C(C=CC1)O[C@H]1/C=C/[C@@](C)(O)[C@H](OP(O)(O[Na])=O)C[C@@H](O)/C=C\C=C/C=C/CO |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/fostriecin-sodium.html |